propan-2-yl 4-oxopentanoate


isopropyl levulinate; propan-2-yl 4-oxopentanoate
CAS RN:[21884-26-4]
Formula:C8H14O3; 158.20 g/mol
InChiKey:MGJRGGIHFUREHT-UHFFFAOYSA-N
SMILES:CC(C)OC(=O)CCC(C)=O
Molecular structure of propan-2-yl 4-oxopentanoate
Boiling point:208 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature

Isomers

butyl 3-oxobutanoate
Molecular structure of butyl 3-oxobutanoate
tert-butyl 3-oxobutanoate
Molecular structure of tert-butyl 3-oxobutanoate
butyric anhydride
Molecular structure of butyric anhydride
(2S)-2-cyclohexyl-2-hydroxyacetic acid
Molecular structure of (2S)-2-cyclohexyl-2-hydroxyacetic acid
2-cyclohexyloxyacetic acid
Molecular structure of 2-cyclohexyloxyacetic acid
di(ethylene glycol) divinyl ether
Molecular structure of di(ethylene glycol) divinyl ether
2-ethoxyethyl methacrylate
Molecular structure of 2-ethoxyethyl methacrylate
ethyl 4-acetylbutyrate
Molecular structure of ethyl 4-acetylbutyrate
ethyl 2,2-dimethyl-3-oxobutanoate
Molecular structure of ethyl 2,2-dimethyl-3-oxobutanoate
ethyl (E)-3-ethoxy-2-butenoate
Molecular structure of ethyl (E)-3-ethoxy-2-butenoate
ethyl 3-ethoxy-2-butenoate
Molecular structure of ethyl 3-ethoxy-2-butenoate
ethyl 2-ethyl-3-oxobutanoate
Molecular structure of ethyl 2-ethyl-3-oxobutanoate
ethyl 1-hydroxycyclopentanecarboxylate
Molecular structure of ethyl 1-hydroxycyclopentanecarboxylate
ethyl 4-methyl-3-oxopentanoate
Molecular structure of ethyl 4-methyl-3-oxopentanoate
ethyl 3-oxohexanoate
Molecular structure of ethyl 3-oxohexanoate
4-ethyl-5-oxohexanoic acid
Molecular structure of 4-ethyl-5-oxohexanoic acid
(3Z)-hex-3-en-1-yl methyl carbonate
Molecular structure of (3Z)-hex-3-en-1-yl methyl carbonate
4-hydroxycyclohexanone ethylene acetal
Molecular structure of 4-hydroxycyclohexanone ethylene acetal
methyl 4,4-dimethyl-3-oxopentanoate
Molecular structure of methyl 4,4-dimethyl-3-oxopentanoate
methyl 2-ethyl-2-methyl-3-oxobutanoate
Molecular structure of methyl 2-ethyl-2-methyl-3-oxobutanoate
methyl 6-oxoheptanoate
Molecular structure of methyl 6-oxoheptanoate
2-methylpropanoic anhydride
Molecular structure of 2-methylpropanoic anhydride
2-methylpropyl 3-oxobutanoate
Molecular structure of 2-methylpropyl 3-oxobutanoate
methyl 2-propyl-3-oxobutanoate
Molecular structure of methyl 2-propyl-3-oxobutanoate
oxolan-2-ylmethyl propanoate
Molecular structure of oxolan-2-ylmethyl propanoate
7-oxooctanoic acid
Molecular structure of 7-oxooctanoic acid
propan-2-yl 4-oxopentanoate
Molecular structure of propan-2-yl 4-oxopentanoate
propyl 4-oxopentanoate
Molecular structure of propyl 4-oxopentanoate
2-propyl-4-oxopentanoic acid
Molecular structure of 2-propyl-4-oxopentanoic acid